/***************************************************************************** * * MODULE: SQL statement parser library * * AUTHOR(S): lex.l and yac.y were originaly taken from unixODBC and * probably written by Peter Harvey , * modifications and other code by Radim Blazek * * PURPOSE: Parse input string containing SQL statement to * SQLPSTMT structure. * SQL parser may be used by simple database drivers. * * COPYRIGHT: (C) 2000 by the GRASS Development Team * * This program is free software under the GNU General Public * License (>=v2). Read the file COPYING that comes with GRASS * for details. * *****************************************************************************/ /**************** C-CODE *****************/ %{ #include #include "y.tab.h" #include #undef YY_INPUT #define YY_INPUT(b, r, ms) (r = my_yyinput(b, ms)) %} /*************** LEX HEADER **************/ %e 1200 /**************** LEX BODY ****************/ %% %{ /*************************************** * LITERALS KEYWORDS TOKENS ***************************************/ /* following case insensitives are ugly but I do not know better at this time */ %} [Aa][Dd][Dd] { return ADD; } [Aa][Ll][Tt][Ee][Rr] { return ALTER; } [Cc][Oo][Ll][Uu][Mm][Nn] { return COLUMN; } [Dd][Ee][Ll][Ee][Tt][Ee] { return DELETE; } [Ff][Rr][Oo][Mm] { return FROM; } [Ii][Nn][Ss][Ee][Rr][Tt] { return INSERT; } [Ii][Nn][Tt][Oo] { return INTO; } [Ss][Ee][Ll][Ee][Cc][Tt] { return SELECT; } [Ss][Ee][Tt] { return SET; } [Uu][Pp][Dd][Aa][Tt][Ee] { return UPDATE; } [Vv][Aa][Ll][Uu][Ee][Ss] { return VALUES; } [Ww][Hh][Ee][Rr][Ee] { return WHERE; } [Aa][Nn][Dd] { return AND; } [Cc][Rr][Ee][Aa][Tt][Ee] { return CREATE; } [Dd][Rr][Oo][Pp] { return DROP; } [Tt][Aa][Bb][Ll][Ee] { return TABLE; } [Nn][Uu][Ll][Ll] { return NULL_VALUE; } [Vv][Aa][Rr][Cc][Hh][Aa][Rr] { return VARCHAR; } [Ii][Nn][Tt] { return INT; } [Ii][Nn][Tt][Ee][Gg][Ee][Rr] { return INTEGER; } [Dd][Oo][Uu][Bb][Ll][Ee] { return DOUBLE; } [Pp][Rr][Ee][Cc][Ii][Ss][Ii][Oo][Nn] { return PRECISION; } [Dd][Aa][Tt][Ee] { return DATE; } [Oo][Rr] { return OR; } [Nn][Oo][Tt] { return NOT; } [Oo][Rr][Dd][Ee][Rr] { return ORDER; } [Bb][Yy] { return BY; } [Ii][Ss] { return IS; } [Ll][Ii][Kk][Ee] { yylval.strval = (char*)strdup("~"); return COMPARISON_OPERATOR; } %{ /* [Dd][Ii][Ss][Tt][Ii][Nn][Cc][Tt] { return DISTINCT; } */ /*************************************** * EQUAL ***************************************/ %} "=" { return EQUAL; } %{ /*************************************** * COMPARISON OPERATOR ***************************************/ %} "<>" | "<" | ">" | "<=" | ">=" | "~" { yylval.strval = (char*)strdup(yytext); return COMPARISON_OPERATOR; } %{ /*************************************** * PUNCTUATION ***************************************/ %} [-+*/:(),.;] { yylval.strval = (char*)strdup(yytext); return yytext[0]; } %{ /*************************************** * NAMES ***************************************/ %} [A-Za-z][A-Za-z0-9_]* { yylval.strval = (char*)strdup(yytext); return NAME; } %{ /*************************************** * INTEGER ***************************************/ %} [0-9]+ { yylval.intval = atoi(yytext); /* yylval.strval = (char*)strdup(yytext); */ return INTNUM; } %{ /*************************************** * FLOATING POINT NUM ***************************************/ %} "."[0-9]* | [0-9]+"."[0-9]* | [0-9]+[eE][+-]?[0-9]+ | [0-9]+"."[0-9]*[eE][+-]?[0-9]+ | "."[0-9]*[eE][+-]?[0-9]+ { yylval.floatval = atof(yytext); /* yylval.strval = (char*)strdup(yytext); */ return FLOATNUM; } %{ /*************************************** * STRINGS (single quotes) ***************************************/ %} '[^']*' { char *Buffer, *ptra, *ptrb; int c = input(); int len; Buffer = (char*)strdup(yytext); /* store here because we lose it when unput() */ unput( c ); /* just peeking - checking for a double quote... embedded quote */ if ( c != '\'' ) { len = strlen (Buffer); Buffer[len-1] = '\0'; /* Hopefully replace all '' by ' */ ptrb = Buffer + 1; while ( (ptra = strchr(ptrb, '\'')) != NULL ) { ptra++; ptrb = ptra; while ( ptra[1] != 0 ) { ptra[0] = ptra[1]; ptra++; } ptra[0] = 0; } yylval.strval = (char*)strdup(Buffer+1); free( Buffer ); return STRING; } else { free( Buffer ); yymore(); } } %{ /*************************************** * STRINGS (unterminated) ***************************************/ %} '[^'\n]*$ { yyerror("Unterminated string"); } %{ /*************************************** * NEW LINE (ignored) ***************************************/ %} \n ; %{ /*************************************** * WHITE SPACE (ignored) ***************************************/ %} [ \t\r]+ ; /* white space */ %{ /*************************************** * COMMENTS (ignored) ***************************************/ %} "--".*$ ; /* comment */ %% /********************************************************************** * * C-CODE * **********************************************************************/ /********************************************************************** * my_yyinput * * Lexer will ask this function for input when it requires more. * **********************************************************************/ int my_yyinput(char *buf, int max_size) { int rest, n; rest = sqlpStmt->stmt + strlen( sqlpStmt->stmt) - sqlpStmt->cur; n = ( max_size < rest ? max_size : rest ); if ( n > 0 ) { memcpy( buf, sqlpStmt->cur, n ); sqlpStmt->cur += n; } return n; } /********************************************************************** * yyerror * * This should be called just before failing. It formats a meaningfull * message and deposits it in a usefull place. * **********************************************************************/ void yyerror( char *s ) { snprintf( sqlpStmt->errmsg, 500, "%s processing '%s'", s, yytext ); #ifdef YY_CURRENT_BUFFER yy_flush_buffer(YY_CURRENT_BUFFER); #endif } /********************************************************************** * yywrap * * We are not doing any buffer switching but lets not use the Flex version of * of this func anyway so we can avoid the link dependency. * **********************************************************************/ int yywrap() { return 1; }